| MolName | 2-[benzenesulfonyl(pyridin-2-yl)amino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C20H17N5O5S |
| Smiles | [O-][N+](c1cccc(/C=N\NC(CN(c2ncccc2)S(c2ccccc2)(=O)=O)=O)c1)=O |
| InChI | InChI=1S/C20H17N5O5S/c26-20(23-22-14-16-7-6-8-17(13-16)25(27)28)15-24(19-11-4-5-12-21-19)31(29,30)18-9-2-1-3-10-18/h1-14H,15H2,(H,23,26) |
| InChIK | RTXKQFBZEGQAOM-UHFFFAOYSA-N |
| TotalMolweight | 439.451 |
| Molweight | 439.451 |
| MonoisotopicMass | 439.09504 |
| CLogP | 1.4797 |
| CLogS | -5.116 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 321.82 |
| Relative PSA | 0.34035 |
| PolarSurfaceArea | 145.93 |
| Druglikeness | -5.2796 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[benzenesulfonyl(pyridin-2-yl)amino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide | 2 - 2-[benzenesulfonyl(pyridin-2-yl)amino]-N-[(Z)-(3-nitrophenyl)methylideneamino]acetamide