| MolName | 3-[(Z)-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C22H16N3O2F3S |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c1ccc(-c2c(C(F)(F)F)cccc2)o1 |
| InChI | InChI=1S/C22H16F3N3O2S/c23-22(24,25)16-7-3-1-5-14(16)17-10-9-13(30-17)11-27-28-12-26-20-19(21(28)29)15-6-2-4-8-18(15)31-20/h1,3,5,7,9-12H,2,4,6,8H2 |
| InChIK | RUDFLUDTVWCYGM-UHFFFAOYSA-N |
| TotalMolweight | 443.448 |
| Molweight | 443.448 |
| MonoisotopicMass | 443.091531 |
| CLogP | 5.4722 |
| CLogS | -7.289 |
| H Acceptors | 5 |
| TotalSurfaceArea | 313.48 |
| Relative PSA | 0.23631 |
| PolarSurfaceArea | 86.41 |
| Druglikeness | -3.8261 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one