| MolName | [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] furan-2-carboxylate |
| MolecularFormula | C29H19N3O7Br2 |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C/c(cc1)cc2c1OCO2)N/N=C\c1cc(Br)cc(Br)c1OC(c1ccco1)=O |
| InChI | InChI=1S/C29H19Br2N3O7/c30-20-13-19(26(21(31)14-20)41-29(37)24-7-4-10-38-24)15-32-34-28(36)22(33-27(35)18-5-2-1-3-6-18)11-17-8-9-23-25(12-17)40-16-39-23/h1-15H,16H2,(H,33,35)(H,34,36) |
| InChIK | RUFCLYYYKVSGBK-UHFFFAOYSA-N |
| TotalMolweight | 681.292 |
| Molweight | 681.292 |
| MonoisotopicMass | 678.958974 |
| CLogP | 6.9993 |
| CLogS | -8.997 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 435.39 |
| Relative PSA | 0.27024 |
| PolarSurfaceArea | 128.46 |
| Druglikeness | 4.127 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43902 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] furan-2-carboxylate | 2 - [2-[(Z)-[[(Z)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] furan-2-carboxylate