| MolName | 6-[(2Z)-2-(naphthalen-1-ylmethylidene)hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| MolecularFormula | C14H11N5O2 |
| Smiles | O=C(C(N/N=C\c1cccc2ccccc12)=NN1)NC1=O |
| InChI | InChI=1S/C14H11N5O2/c20-13-12(18-19-14(21)16-13)17-15-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-8H,(H,17,18)(H2,16,19,20,21) |
| InChIK | RUQHLTHDIXQJEP-UHFFFAOYSA-N |
| TotalMolweight | 281.274 |
| Molweight | 281.274 |
| MonoisotopicMass | 281.091275 |
| CLogP | 1.4553 |
| CLogS | -4.775 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 211.97 |
| Relative PSA | 0.39383 |
| PolarSurfaceArea | 94.95 |
| Druglikeness | 5.6134 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-[(2Z)-2-(naphthalen-1-ylmethylidene)hydrazinyl]-2H-1,2,4-triazine-3,5-dione | 2 - 6-[(2Z)-2-(naphthalen-1-ylmethylidene)hydrazinyl]-2H-1,2,4-triazine-3,5-dione