| MolName | N-[(Z)-naphthalen-1-ylmethylideneamino]formamide |
| MolecularFormula | C12H10N2O |
| Smiles | O=CN/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C12H10N2O/c15-9-14-13-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H,(H,14,15) |
| InChIK | RUSAJJWCUJPRKR-UHFFFAOYSA-N |
| TotalMolweight | 198.224 |
| Molweight | 198.224 |
| MonoisotopicMass | 198.079313 |
| CLogP | 2.5814 |
| CLogS | -4.326 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 163.62 |
| Relative PSA | 0.22008 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.2148 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-1-ylmethylideneamino]formamide | 2 - N-[(Z)-naphthalen-1-ylmethylideneamino]formamide