| MolName | 4,6-dimorpholin-4-yl-N-[(Z)-naphthalen-2-ylmethylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C22H25N7O2 |
| Smiles | C(COCC1)N1c1nc(N/N=C\c2cc3ccccc3cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H25N7O2/c1-2-4-19-15-17(5-6-18(19)3-1)16-23-27-20-24-21(28-7-11-30-12-8-28)26-22(25-20)29-9-13-31-14-10-29/h1-6,15-16H,7-14H2,(H,24,25,26,27) |
| InChIK | RUSLEEILOHQTEV-UHFFFAOYSA-N |
| TotalMolweight | 419.488 |
| Molweight | 419.488 |
| MonoisotopicMass | 419.206973 |
| CLogP | 4.7949 |
| CLogS | -5.147 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 323.8 |
| Relative PSA | 0.25627 |
| PolarSurfaceArea | 88 |
| Druglikeness | 3.2985 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 10 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-dimorpholin-4-yl-N-[(Z)-naphthalen-2-ylmethylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-dimorpholin-4-yl-N-[(Z)-naphthalen-2-ylmethylideneamino]-1,3,5-triazin-2-amine