| MolName | (1R,2R,6S,7S,8S,10R)-4-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| MolecularFormula | C23H17N2O3F3 |
| Smiles | O=C([C@H]1[C@H]([C@@H]2[C@H]3C2)C=C[C@H]3[C@H]1C1=O)N1/N=C\c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C23H17F3N2O3/c24-23(25,26)12-3-1-2-11(8-12)18-7-4-13(31-18)10-27-28-21(29)19-14-5-6-15(17-9-16(14)17)20(19)22(28)30/h1-8,10,14-17,19-20H,9H2/t14-,15+,16-,17-,19+,20-/m1/s1 |
| InChIK | RVDYFDAXNLKYJU-GHSJJHLASA-N |
| TotalMolweight | 426.393 |
| Molweight | 426.393 |
| MonoisotopicMass | 426.119127 |
| CLogP | 3.7711 |
| CLogS | -5.912 |
| H Acceptors | 5 |
| TotalSurfaceArea | 283.99 |
| Relative PSA | 0.19455 |
| PolarSurfaceArea | 62.88 |
| Druglikeness | 0.093132 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 9 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1R,2R,6S,7S,8S,10R)-4-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione | 2 - (1R,2R,6S,7S,8S,10R)-4-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione