| MolName | 3-[(Z)-(2-amino-3-thiophen-2-ylsulfonylpyrrolo[3,2-b]quinoxalin-1-yl)iminomethyl]phenol |
| MolecularFormula | C21H15N5O3S2 |
| Smiles | Nc(n(c1nc2ccccc2nc11)/N=C\c2cc(O)ccc2)c1S(c1cccs1)(=O)=O |
| InChI | InChI=1S/C21H15N5O3S2/c22-20-19(31(28,29)17-9-4-10-30-17)18-21(25-16-8-2-1-7-15(16)24-18)26(20)23-12-13-5-3-6-14(27)11-13/h1-12,27H,22H2 |
| InChIK | RVOOLNVVFOCGTD-UHFFFAOYSA-N |
| TotalMolweight | 449.514 |
| Molweight | 449.514 |
| MonoisotopicMass | 449.06163 |
| CLogP | 3.3635 |
| CLogS | -8.189 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 312.85 |
| Relative PSA | 0.37599 |
| PolarSurfaceArea | 160.08 |
| Druglikeness | 4.1011 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.41935 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2-amino-3-thiophen-2-ylsulfonylpyrrolo[3,2-b]quinoxalin-1-yl)iminomethyl]phenol | 2 - 3-[(Z)-(2-amino-3-thiophen-2-ylsulfonylpyrrolo[3,2-b]quinoxalin-1-yl)iminomethyl]phenol