| MolName | 4-amino-N-[(Z)-(5-thiophen-2-ylthiophen-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C12H9N5O2S2 |
| Smiles | Nc1nonc1C(N/N=C\c1ccc(-c2cccs2)s1)=O |
| InChI | InChI=1S/C12H9N5O2S2/c13-11-10(16-19-17-11)12(18)15-14-6-7-3-4-9(21-7)8-2-1-5-20-8/h1-6H,(H2,13,17)(H,15,18) |
| InChIK | RWCAOIHOQDJYRK-UHFFFAOYSA-N |
| TotalMolweight | 319.368 |
| Molweight | 319.368 |
| MonoisotopicMass | 319.019765 |
| CLogP | 3.2294 |
| CLogS | -4.627 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 234.36 |
| Relative PSA | 0.54638 |
| PolarSurfaceArea | 162.88 |
| Druglikeness | 7.8943 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(5-thiophen-2-ylthiophen-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-(5-thiophen-2-ylthiophen-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide