| MolName | N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]furan-2-carboxamide |
| MolecularFormula | C19H14N4O2S |
| Smiles | O=C(c1ccco1)N/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C19H14N4O2S/c24-19(16-8-4-10-25-16)21-20-12-14-13-23(15-6-2-1-3-7-15)22-18(14)17-9-5-11-26-17/h1-13H,(H,21,24) |
| InChIK | RWGNYGAGYWWDOB-UHFFFAOYSA-N |
| TotalMolweight | 362.412 |
| Molweight | 362.412 |
| MonoisotopicMass | 362.083746 |
| CLogP | 3.3328 |
| CLogS | -4.837 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 280.1 |
| Relative PSA | 0.31532 |
| PolarSurfaceArea | 100.66 |
| Druglikeness | 6.9611 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]furan-2-carboxamide | 2 - N-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]furan-2-carboxamide