| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetamide |
| MolecularFormula | C19H19N2O2Cl |
| Smiles | O=C(COc1cc(CCCC2)c2cc1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C19H19ClN2O2/c20-18-8-4-3-7-16(18)12-21-22-19(23)13-24-17-10-9-14-5-1-2-6-15(14)11-17/h3-4,7-12H,1-2,5-6,13H2,(H,22,23) |
| InChIK | RWZOXOPXZPDGDU-UHFFFAOYSA-N |
| TotalMolweight | 342.825 |
| Molweight | 342.825 |
| MonoisotopicMass | 342.113505 |
| CLogP | 4.5393 |
| CLogS | -5.329 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 267.71 |
| Relative PSA | 0.17187 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | -1.1305 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetamide