| MolName | [4-[(Z)-[[2-[[(Z)-[4-(2,4-dichlorobenzoyl)oxy-3-nitrophenyl]methylideneamino]carbamoyl]-3-(4-nitrophenyl)prop-2-enoyl]hydrazinylidene]methyl]-2-nitrophenyl] 2,4-dichlorobenzoate |
| MolecularFormula | C38H21N7O12Cl4 |
| Smiles | [O-][N+](c1ccc(C=C(C(N/N=C\c(cc2)cc([N+]([O-])=O)c2OC(c(ccc(Cl)c2)c2Cl)=O)=O)C(N/N=C\c(cc2)cc([N+]([O-])=O)c2OC(c(ccc(Cl)c2)c2Cl)=O)=O)cc1)=O |
| InChI | InChI=1S/C38H21Cl4N7O12/c39-23-5-9-26(29(41)16-23)37(52)60-33-11-3-21(14-31(33)48(56)57)18-43-45-35(50)28(13-20-1-7-25(8-2-20)47(54)55)36(51)46-44-19-22-4-12-34(32(15-22)49(58)59)61-38(53)27-10-6-24(40)17-30(27)42/h1-19H,(H,45,50)(H,46,51) |
| InChIK | RXCPEVGUYFFZRQ-UHFFFAOYSA-N |
| TotalMolweight | 909.434 |
| Molweight | 909.434 |
| MonoisotopicMass | 907.000231 |
| CLogP | 7.438 |
| CLogS | -13.046 |
| H Acceptors | 19 |
| H Donors | 2 |
| TotalSurfaceArea | 633.14 |
| Relative PSA | 0.33067 |
| PolarSurfaceArea | 272.98 |
| Druglikeness | 0.27442 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | twice activated DB; aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5082 |
| Fragments | 1 |
| Non HAtoms | 61 |
| NonCHAtoms | 23 |
| Electronegative Atoms | 23 |
| Rotatable Bond | 16 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 5 |
| Symmetricatoms | 27 |
| AcidicOxygens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[[(Z)-[4-(2,4-dichlorobenzoyl)oxy-3-nitrophenyl]methylideneamino]carbamoyl]-3-(4-nitrophenyl)prop-2-enoyl]hydrazinylidene]methyl]-2-nitrophenyl] 2,4-dichlorobenzoate | 2 - [4-[(Z)-[[2-[[(Z)-[4-(2,4-dichlorobenzoyl)oxy-3-nitrophenyl]methylideneamino]carbamoyl]-3-(4-nitrophenyl)prop-2-enoyl]hydrazinylidene]methyl]-2-nitrophenyl] 2,4-dichlorobenzoate