| MolName | 2-N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C26H19N8O3F |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(Nc2ccccc2)nc(N/N=C\c2ccc(-c(cc3)ccc3F)o2)n1)=O |
| InChI | InChI=1S/C26H19FN8O3/c27-18-8-6-17(7-9-18)23-15-14-22(38-23)16-28-34-26-32-24(29-19-4-2-1-3-5-19)31-25(33-26)30-20-10-12-21(13-11-20)35(36)37/h1-16H,(H3,29,30,31,32,33,34) |
| InChIK | RXEISWNEIFCVRR-UHFFFAOYSA-N |
| TotalMolweight | 510.488 |
| Molweight | 510.488 |
| MonoisotopicMass | 510.156415 |
| CLogP | 6.9302 |
| CLogS | -8.725 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 387.43 |
| Relative PSA | 0.31833 |
| PolarSurfaceArea | 146.08 |
| Druglikeness | -1.9681 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine