| MolName | 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C25H19N6O3ClS |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(CSc2nnc(-c(cc3)ccc3Cl)n2-c2ccccc2)=O)cccc1)=O |
| InChI | InChI=1S/C25H19ClN6O3S/c26-20-14-12-19(13-15-20)24-29-30-25(31(24)21-9-2-1-3-10-21)36-17-23(33)28-27-16-6-8-18-7-4-5-11-22(18)32(34)35/h1-16H,17H2,(H,28,33) |
| InChIK | RXRCDSISIPEEDJ-UHFFFAOYSA-N |
| TotalMolweight | 518.984 |
| Molweight | 518.984 |
| MonoisotopicMass | 518.092786 |
| CLogP | 4.2345 |
| CLogS | -9.904 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 390.07 |
| Relative PSA | 0.289 |
| PolarSurfaceArea | 143.29 |
| Druglikeness | 0.41667 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide | 2 - 2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide