| MolName | N-[(Z)-naphthalen-1-ylmethylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C27H20N6O3S |
| Smiles | [O-][N+](c1cccc(-c(n2-c3ccccc3)nnc2SCC(N/N=C\c2cccc3ccccc23)=O)c1)=O |
| InChI | InChI=1S/C27H20N6O3S/c34-25(29-28-17-21-11-6-9-19-8-4-5-15-24(19)21)18-37-27-31-30-26(32(27)22-12-2-1-3-13-22)20-10-7-14-23(16-20)33(35)36/h1-17H,18H2,(H,29,34) |
| InChIK | RXTCETYOCQIQOF-UHFFFAOYSA-N |
| TotalMolweight | 508.561 |
| Molweight | 508.561 |
| MonoisotopicMass | 508.131759 |
| CLogP | 4.8046 |
| CLogS | -10.482 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 382.75 |
| Relative PSA | 0.29453 |
| PolarSurfaceArea | 143.29 |
| Druglikeness | 0.30503 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-1-ylmethylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-naphthalen-1-ylmethylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide