| MolName | [2-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-4-nitrophenyl] benzoate |
| MolecularFormula | C23H17N3O7 |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(c(cc2)cc3c2OCCO3)=O)c1OC(c1ccccc1)=O)=O |
| InChI | InChI=1S/C23H17N3O7/c27-22(16-6-8-20-21(13-16)32-11-10-31-20)25-24-14-17-12-18(26(29)30)7-9-19(17)33-23(28)15-4-2-1-3-5-15/h1-9,12-14H,10-11H2,(H,25,27) |
| InChIK | RXUYCOWGSKUERO-UHFFFAOYSA-N |
| TotalMolweight | 447.402 |
| Molweight | 447.402 |
| MonoisotopicMass | 447.106652 |
| CLogP | 3.6893 |
| CLogS | -5.833 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 332.19 |
| Relative PSA | 0.32954 |
| PolarSurfaceArea | 132.04 |
| Druglikeness | -8.1529 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-4-nitrophenyl] benzoate | 2 - [2-[(Z)-(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-4-nitrophenyl] benzoate