| MolName | (Z)-N-[(Z)-thiophen-2-ylmethylideneamino]fluoren-9-imine |
| MolecularFormula | C18H12N2S |
| Smiles | C(c1cccs1)=N\N=C1c(cccc2)c2-c2c1cccc2 |
| InChI | InChI=1S/C18H12N2S/c1-3-9-16-14(7-1)15-8-2-4-10-17(15)18(16)20-19-12-13-6-5-11-21-13/h1-12H |
| InChIK | RXWHXBGPYVTLOI-UHFFFAOYSA-N |
| TotalMolweight | 288.373 |
| Molweight | 288.373 |
| MonoisotopicMass | 288.072118 |
| CLogP | 6.2352 |
| CLogS | -6.918 |
| H Acceptors | 2 |
| TotalSurfaceArea | 222.95 |
| Relative PSA | 0.19457 |
| PolarSurfaceArea | 52.96 |
| Druglikeness | 3.7807 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-thiophen-2-ylmethylideneamino]fluoren-9-imine | 2 - (Z)-N-[(Z)-thiophen-2-ylmethylideneamino]fluoren-9-imine