| MolName | 4-[(Z)-[4-[(Z)-(4-carboxyphenyl)methylideneamino]piperazin-1-yl]iminomethyl]benzoic acid |
| MolecularFormula | C20H20N4O4 |
| Smiles | OC(c1ccc(/C=N\N(CC2)CCN2/N=C\c(cc2)ccc2C(O)=O)cc1)=O |
| InChI | InChI=1S/C20H20N4O4/c25-19(26)17-5-1-15(2-6-17)13-21-23-9-11-24(12-10-23)22-14-16-3-7-18(8-4-16)20(27)28/h1-8,13-14H,9-12H2,(H,25,26)(H,27,28) |
| InChIK | RXYHQZINPHMWQQ-UHFFFAOYSA-N |
| TotalMolweight | 380.403 |
| Molweight | 380.403 |
| MonoisotopicMass | 380.148456 |
| CLogP | 2.2292 |
| CLogS | -3.316 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 292.88 |
| Relative PSA | 0.28134 |
| PolarSurfaceArea | 105.8 |
| Druglikeness | 4.8563 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 17 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[4-[(Z)-(4-carboxyphenyl)methylideneamino]piperazin-1-yl]iminomethyl]benzoic acid | 2 - 4-[(Z)-[4-[(Z)-(4-carboxyphenyl)methylideneamino]piperazin-1-yl]iminomethyl]benzoic acid