| MolName | (2S,3S)-N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]-2,3-dihydroxybutanediamide |
| MolecularFormula | C18H16N4O4Cl2 |
| Smiles | O[C@@H]([C@@H](C(N/N=C\c(cc1)ccc1Cl)=O)O)C(N/N=C\c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C18H16Cl2N4O4/c19-13-5-1-11(2-6-13)9-21-23-17(27)15(25)16(26)18(28)24-22-10-12-3-7-14(20)8-4-12/h1-10,15-16,25-26H,(H,23,27)(H,24,28)/t15-,16-/m0/s1 |
| InChIK | RZCYJYNVTIBMMF-HOTGVXAUSA-N |
| TotalMolweight | 423.255 |
| Molweight | 423.255 |
| MonoisotopicMass | 422.05486 |
| CLogP | 2.6156 |
| CLogS | -5.332 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 309.5 |
| Relative PSA | 0.31735 |
| PolarSurfaceArea | 123.38 |
| Druglikeness | 5.3514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 2 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 16 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2S,3S)-N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]-2,3-dihydroxybutanediamide | 2 - (2S,3S)-N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]-2,3-dihydroxybutanediamide