| MolName | N-[(Z)-cyclohexylmethylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C13H17N3O |
| Smiles | O=C(c1cnccc1)N/N=C\C1CCCCC1 |
| InChI | InChI=1S/C13H17N3O/c17-13(12-7-4-8-14-10-12)16-15-9-11-5-2-1-3-6-11/h4,7-11H,1-3,5-6H2,(H,16,17) |
| InChIK | RZDYAGJCMUQQKO-UHFFFAOYSA-N |
| TotalMolweight | 231.298 |
| Molweight | 231.298 |
| MonoisotopicMass | 231.137162 |
| CLogP | 1.7901 |
| CLogS | -3.004 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 193.79 |
| Relative PSA | 0.24243 |
| PolarSurfaceArea | 54.35 |
| Druglikeness | -0.46332 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-cyclohexylmethylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-cyclohexylmethylideneamino]pyridine-3-carboxamide