| MolName | 2-(2-phenoxyethoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzamide |
| MolecularFormula | C24H22N2O3 |
| Smiles | O=C(c(cccc1)c1OCCOc1ccccc1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C24H22N2O3/c27-24(26-25-17-9-12-20-10-3-1-4-11-20)22-15-7-8-16-23(22)29-19-18-28-21-13-5-2-6-14-21/h1-17H,18-19H2,(H,26,27) |
| InChIK | RZMATQNBWJXHPV-UHFFFAOYSA-N |
| TotalMolweight | 386.45 |
| Molweight | 386.45 |
| MonoisotopicMass | 386.163043 |
| CLogP | 4.5749 |
| CLogS | -5.281 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 320.77 |
| Relative PSA | 0.17461 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | -2.7996 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68966 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-phenoxyethoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzamide | 2 - 2-(2-phenoxyethoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]benzamide