| MolName | 2-(benzenesulfonamido)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
| MolecularFormula | C26H22N3O4FS |
| Smiles | O=C(CNS(c1ccccc1)(=O)=O)N/N=C\c(c1ccccc1cc1)c1OCc(cc1)ccc1F |
| InChI | InChI=1S/C26H22FN3O4S/c27-21-13-10-19(11-14-21)18-34-25-15-12-20-6-4-5-9-23(20)24(25)16-28-30-26(31)17-29-35(32,33)22-7-2-1-3-8-22/h1-16,29H,17-18H2,(H,30,31) |
| InChIK | RZOOKBYIUHKJNN-UHFFFAOYSA-N |
| TotalMolweight | 491.542 |
| Molweight | 491.542 |
| MonoisotopicMass | 491.131505 |
| CLogP | 4.6152 |
| CLogS | -6.297 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 365.26 |
| Relative PSA | 0.23559 |
| PolarSurfaceArea | 105.24 |
| Druglikeness | -4.4024 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(benzenesulfonamido)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide | 2 - 2-(benzenesulfonamido)-N-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide