| MolName | N-[(E)-3-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C25H20N4O6 |
| Smiles | [O-][N+](c1ccc(/C=C(\C(N/N=C\c(cc2)cc3c2OCCO3)=O)/NC(c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C25H20N4O6/c30-24(19-4-2-1-3-5-19)27-21(14-17-6-9-20(10-7-17)29(32)33)25(31)28-26-16-18-8-11-22-23(15-18)35-13-12-34-22/h1-11,14-16H,12-13H2,(H,27,30)(H,28,31) |
| InChIK | RZYCQZHRCLXHID-UHFFFAOYSA-N |
| TotalMolweight | 472.456 |
| Molweight | 472.456 |
| MonoisotopicMass | 472.138286 |
| CLogP | 3.8755 |
| CLogS | -6.108 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 358.36 |
| Relative PSA | 0.30955 |
| PolarSurfaceArea | 134.84 |
| Druglikeness | -5.8232 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-3-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-3-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide