| MolName | 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C22H17N6O2ClS |
| Smiles | O=C(CSc1nnc(-c2ccncc2)n1-c(cc1)ccc1Cl)N/N=C\C=C\c1ccco1 |
| InChI | InChI=1S/C22H17ClN6O2S/c23-17-5-7-18(8-6-17)29-21(16-9-12-24-13-10-16)27-28-22(29)32-15-20(30)26-25-11-1-3-19-4-2-14-31-19/h1-14H,15H2,(H,26,30) |
| InChIK | SAOVNYZSWYKMDM-UHFFFAOYSA-N |
| TotalMolweight | 464.936 |
| Molweight | 464.936 |
| MonoisotopicMass | 464.082221 |
| CLogP | 3.3439 |
| CLogS | -8.331 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 354.85 |
| Relative PSA | 0.30263 |
| PolarSurfaceArea | 123.5 |
| Druglikeness | 5.3854 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide | 2 - 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]acetamide