| MolName | N-phenyl-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]butanediamide |
| MolecularFormula | C24H23N3O3 |
| Smiles | O=C(CCC(N/N=C\c(cccc1)c1OCc1ccccc1)=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H23N3O3/c28-23(26-21-12-5-2-6-13-21)15-16-24(29)27-25-17-20-11-7-8-14-22(20)30-18-19-9-3-1-4-10-19/h1-14,17H,15-16,18H2,(H,26,28)(H,27,29) |
| InChIK | SBEBSELYFBICFD-UHFFFAOYSA-N |
| TotalMolweight | 401.465 |
| Molweight | 401.465 |
| MonoisotopicMass | 401.173942 |
| CLogP | 4.4008 |
| CLogS | -5.406 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 327.24 |
| Relative PSA | 0.21547 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 3.3221 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-phenyl-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]butanediamide | 2 - N-phenyl-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]butanediamide