| MolName | 2-N,2-N-diphenyl-4-N,6-N-bis[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C27H22N10 |
| Smiles | C(c1cnccc1)=N\Nc1nc(N(c2ccccc2)c2ccccc2)nc(N/N=C\c2cnccc2)n1 |
| InChI | InChI=1S/C27H22N10/c1-3-11-23(12-4-1)37(24-13-5-2-6-14-24)27-33-25(35-30-19-21-9-7-15-28-17-21)32-26(34-27)36-31-20-22-10-8-16-29-18-22/h1-20H,(H2,32,33,34,35,36) |
| InChIK | SBLDQGMLHLWUAJ-UHFFFAOYSA-N |
| TotalMolweight | 486.542 |
| Molweight | 486.542 |
| MonoisotopicMass | 486.20289 |
| CLogP | 8.0364 |
| CLogS | -7.454 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 388.84 |
| Relative PSA | 0.26834 |
| PolarSurfaceArea | 116.47 |
| Druglikeness | 3.1892 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 19 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N,2-N-diphenyl-4-N,6-N-bis[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine | 2 - 2-N,2-N-diphenyl-4-N,6-N-bis[(Z)-pyridin-3-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine