| MolName | 4-[(Z)-[[2-(cyclohexylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C16H18N3O4 |
| Smiles | [O-]C(c1ccc(/C=N\NC(C(NC2CCCCC2)=O)=O)cc1)=O |
| InChI | InChI=1S/C16H19N3O4/c20-14(18-13-4-2-1-3-5-13)15(21)19-17-10-11-6-8-12(9-7-11)16(22)23/h6-10,13H,1-5H2,(H,18,20)(H,19,21)(H,22,23)/p-1 |
| InChIK | SBMJWWIBJCNAHG-UHFFFAOYSA-M |
| TotalMolweight | 316.336 |
| Molweight | 316.336 |
| MonoisotopicMass | 316.129732 |
| CLogP | -0.6 |
| CLogS | -3.605 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 249.52 |
| Relative PSA | 0.352 |
| PolarSurfaceArea | 110.69 |
| Druglikeness | -0.53723 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-(cyclohexylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-(cyclohexylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate