| MolName | 4-amino-N-[(Z)-[1-[(3-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C19H15N6O2Cl |
| Smiles | Nc1nonc1C(N/N=C\c1cn(Cc2cccc(Cl)c2)c2c1cccc2)=O |
| InChI | InChI=1S/C19H15ClN6O2/c20-14-5-3-4-12(8-14)10-26-11-13(15-6-1-2-7-16(15)26)9-22-23-19(27)17-18(21)25-28-24-17/h1-9,11H,10H2,(H2,21,25)(H,23,27) |
| InChIK | SBVMIBDBNHHLLE-UHFFFAOYSA-N |
| TotalMolweight | 394.821 |
| Molweight | 394.821 |
| MonoisotopicMass | 394.094501 |
| CLogP | 3.5767 |
| CLogS | -4.303 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 295.46 |
| Relative PSA | 0.31882 |
| PolarSurfaceArea | 111.33 |
| Druglikeness | 7.6907 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[1-[(3-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[1-[(3-chlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide