| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-1H-indole-3-carboxamide |
| MolecularFormula | C30H22N4O |
| Smiles | O=C(c1c[nH]c2c1cccc2)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C30H22N4O/c35-30(26-19-31-27-17-9-7-15-23(26)27)33-32-20-25-24-16-8-10-18-28(24)34(22-13-5-2-6-14-22)29(25)21-11-3-1-4-12-21/h1-20,31H,(H,33,35) |
| InChIK | SBVVBFYTOFGWQG-UHFFFAOYSA-N |
| TotalMolweight | 454.532 |
| Molweight | 454.532 |
| MonoisotopicMass | 454.179361 |
| CLogP | 6.493 |
| CLogS | -9.838 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 354.48 |
| Relative PSA | 0.16043 |
| PolarSurfaceArea | 62.18 |
| Druglikeness | 6.1799 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-1H-indole-3-carboxamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-1H-indole-3-carboxamide