| MolName | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C17H12N3O2F3S |
| Smiles | O=C(CSc1nc(cccc2)c2o1)N/N=C\c1cc(C(F)(F)F)ccc1 |
| InChI | InChI=1S/C17H12F3N3O2S/c18-17(19,20)12-5-3-4-11(8-12)9-21-23-15(24)10-26-16-22-13-6-1-2-7-14(13)25-16/h1-9H,10H2,(H,23,24) |
| InChIK | SDBZDYHFTFAEFT-UHFFFAOYSA-N |
| TotalMolweight | 379.361 |
| Molweight | 379.361 |
| MonoisotopicMass | 379.060231 |
| CLogP | 4.5166 |
| CLogS | -5.655 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 270.75 |
| Relative PSA | 0.29023 |
| PolarSurfaceArea | 92.79 |
| Druglikeness | -2.4992 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide | 2 - 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]acetamide