| MolName | N-[(Z)-[4-[(Z)-(pyridin-2-ylhydrazinylidene)methyl]phenyl]methylideneamino]pyridin-2-amine |
| MolecularFormula | C18H16N6 |
| Smiles | C(c1ccc(/C=N\Nc2ncccc2)cc1)=N\Nc1ncccc1 |
| InChI | InChI=1S/C18H16N6/c1-3-11-19-17(5-1)23-21-13-15-7-9-16(10-8-15)14-22-24-18-6-2-4-12-20-18/h1-14H,(H,19,23)(H,20,24) |
| InChIK | SEAFNPOVWHLNNQ-UHFFFAOYSA-N |
| TotalMolweight | 316.367 |
| Molweight | 316.367 |
| MonoisotopicMass | 316.143644 |
| CLogP | 6.7232 |
| CLogS | -4.142 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 262.74 |
| Relative PSA | 0.25835 |
| PolarSurfaceArea | 74.56 |
| Druglikeness | 2.4225 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 13 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(Z)-(pyridin-2-ylhydrazinylidene)methyl]phenyl]methylideneamino]pyridin-2-amine | 2 - N-[(Z)-[4-[(Z)-(pyridin-2-ylhydrazinylidene)methyl]phenyl]methylideneamino]pyridin-2-amine