| MolName | 2-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
| MolecularFormula | C23H17N6O4S |
| Smiles | [O-]c(cc1)c(/C=N\NC(CSc2nnc(-c3ccccc3)n2-c2ccccc2)=O)cc1[N+]([O-])=O |
| InChI | InChI=1S/C23H18N6O4S/c30-20-12-11-19(29(32)33)13-17(20)14-24-25-21(31)15-34-23-27-26-22(16-7-3-1-4-8-16)28(23)18-9-5-2-6-10-18/h1-14,30H,15H2,(H,25,31)/p-1 |
| InChIK | SEDBVLNUWYKSOO-UHFFFAOYSA-M |
| TotalMolweight | 473.492 |
| Molweight | 473.492 |
| MonoisotopicMass | 473.103199 |
| CLogP | 1.6865 |
| CLogS | -8.58 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 355.68 |
| Relative PSA | 0.35709 |
| PolarSurfaceArea | 166.35 |
| Druglikeness | 0.29732 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-4-nitrophenolate | 2 - 2-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-4-nitrophenolate