| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]thiadiazole-4-carboxamide |
| MolecularFormula | C10H7N4OFS |
| Smiles | O=C(c1csnn1)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C10H7FN4OS/c11-8-3-1-7(2-4-8)5-12-14-10(16)9-6-17-15-13-9/h1-6H,(H,14,16) |
| InChIK | SEEZAERQTPGDHV-UHFFFAOYSA-N |
| TotalMolweight | 250.257 |
| Molweight | 250.257 |
| MonoisotopicMass | 250.032459 |
| CLogP | 2.2872 |
| CLogS | -3.696 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 186.8 |
| Relative PSA | 0.41922 |
| PolarSurfaceArea | 95.48 |
| Druglikeness | -0.34764 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]thiadiazole-4-carboxamide | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]thiadiazole-4-carboxamide