| MolName | 2-[2-[(Z)-[(3-morpholin-4-ylsulfonylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C20H20N3O7S |
| Smiles | [O-]C(COc1c(/C=N\NC(c2cccc(S(N3CCOCC3)(=O)=O)c2)=O)cccc1)=O |
| InChI | InChI=1S/C20H21N3O7S/c24-19(25)14-30-18-7-2-1-4-16(18)13-21-22-20(26)15-5-3-6-17(12-15)31(27,28)23-8-10-29-11-9-23/h1-7,12-13H,8-11,14H2,(H,22,26)(H,24,25)/p-1 |
| InChIK | SEJNRUOTIXKQLQ-UHFFFAOYSA-M |
| TotalMolweight | 446.459 |
| Molweight | 446.459 |
| MonoisotopicMass | 446.102197 |
| CLogP | -0.7716 |
| CLogS | -2.72 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 326.45 |
| Relative PSA | 0.35368 |
| PolarSurfaceArea | 145.81 |
| Druglikeness | 1.2857 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[(3-morpholin-4-ylsulfonylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[2-[(Z)-[(3-morpholin-4-ylsulfonylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate