| MolName | (1S,2S,4R)-N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]bicyclo[2.2.1]heptane-2-carboxamide |
| MolecularFormula | C16H24N2O |
| Smiles | O=C([C@@H]1[C@@H](CC2)C[C@@H]2C1)N/N=C\[C@@H]1[C@H](CC2)C[C@H]2C1 |
| InChI | InChI=1S/C16H24N2O/c19-16(15-8-11-2-4-13(15)6-11)18-17-9-14-7-10-1-3-12(14)5-10/h9-15H,1-8H2,(H,18,19)/t10-,11+,12+,13-,14+,15-/m0/s1 |
| InChIK | SETCSWXEUHFLEF-MTWVNVMRSA-N |
| TotalMolweight | 260.38 |
| Molweight | 260.38 |
| MonoisotopicMass | 260.188863 |
| CLogP | 2.4981 |
| CLogS | -4.227 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 198.55 |
| Relative PSA | 0.18136 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.4704 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| StereoCenters | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 6 |
| Sp3Atoms | 14 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1S,2S,4R)-N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]bicyclo[2.2.1]heptane-2-carboxamide | 2 - (1S,2S,4R)-N-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]bicyclo[2.2.1]heptane-2-carboxamide