| MolName | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C19H22N10O4 |
| Smiles | NC(COc1ccc(/C=N\NC(c2c(CN3CCCC3)nnn2-c2nonc2N)=O)cc1)=O |
| InChI | InChI=1S/C19H22N10O4/c20-15(30)11-32-13-5-3-12(4-6-13)9-22-24-19(31)16-14(10-28-7-1-2-8-28)23-27-29(16)18-17(21)25-33-26-18/h3-6,9H,1-2,7-8,10-11H2,(H2,20,30)(H2,21,25)(H,24,31) |
| InChIK | SEUOYQDMLFINKO-UHFFFAOYSA-N |
| TotalMolweight | 454.45 |
| Molweight | 454.45 |
| MonoisotopicMass | 454.18255 |
| CLogP | 0.8255 |
| CLogS | -1.521 |
| H Acceptors | 14 |
| H Donors | 3 |
| TotalSurfaceArea | 344.83 |
| Relative PSA | 0.4582 |
| PolarSurfaceArea | 192.67 |
| Druglikeness | 3.4223 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide | 2 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide