| MolName | N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-3-chloro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C19H13N2O3ClS |
| Smiles | O=C(c(sc1c2cccc1)c2Cl)N/N=C\C=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C19H13ClN2O3S/c20-17-13-5-1-2-6-16(13)26-18(17)19(23)22-21-9-3-4-12-7-8-14-15(10-12)25-11-24-14/h1-10H,11H2,(H,22,23) |
| InChIK | SEXWSTXXUHDFPM-UHFFFAOYSA-N |
| TotalMolweight | 384.842 |
| Molweight | 384.842 |
| MonoisotopicMass | 384.03354 |
| CLogP | 4.8585 |
| CLogS | -6.809 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 279.71 |
| Relative PSA | 0.27303 |
| PolarSurfaceArea | 88.16 |
| Druglikeness | 5.5252 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-3-chloro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enylidene]amino]-3-chloro-1-benzothiophene-2-carboxamide