| MolName | N-[(Z)-thiophen-2-ylmethylideneamino]adamantane-1-carboxamide |
| MolecularFormula | C16H20N2OS |
| Smiles | O=C(C1(CC(C2)C3)CC3CC2C1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C16H20N2OS/c19-15(18-17-10-14-2-1-3-20-14)16-7-11-4-12(8-16)6-13(5-11)9-16/h1-3,10-13H,4-9H2,(H,18,19) |
| InChIK | SFJOBWVOISUSNZ-UHFFFAOYSA-N |
| TotalMolweight | 288.414 |
| Molweight | 288.414 |
| MonoisotopicMass | 288.129633 |
| CLogP | 3.5215 |
| CLogS | -4.716 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 213.14 |
| Relative PSA | 0.26447 |
| PolarSurfaceArea | 69.7 |
| Druglikeness | 6.7467 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 5 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 10 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-2-ylmethylideneamino]adamantane-1-carboxamide | 2 - N-[(Z)-thiophen-2-ylmethylideneamino]adamantane-1-carboxamide