| MolName | [4-bromo-2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] (Z)-3-(furan-2-yl)prop-2-enoate |
| MolecularFormula | C25H17N2O5Br |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c(cc(cc1)Br)c1OC(/C=C\c1ccco1)=O)=O |
| InChI | InChI=1S/C25H17BrN2O5/c26-19-7-9-23(33-24(30)10-8-20-6-3-11-32-20)18(12-19)15-27-28-25(31)21-13-16-4-1-2-5-17(16)14-22(21)29/h1-15,29H,(H,28,31) |
| InChIK | SFUXQLSXUSDLNR-UHFFFAOYSA-N |
| TotalMolweight | 505.323 |
| Molweight | 505.323 |
| MonoisotopicMass | 504.032084 |
| CLogP | 5.7239 |
| CLogS | -7.387 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 350.27 |
| Relative PSA | 0.24627 |
| PolarSurfaceArea | 101.13 |
| Druglikeness | 0.042463 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] (Z)-3-(furan-2-yl)prop-2-enoate | 2 - [4-bromo-2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] (Z)-3-(furan-2-yl)prop-2-enoate