| MolName | N-[(E)-1-(2-hydroxyphenyl)-3-[(2Z)-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C27H20N4O6 |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\NC(/C(/NC(c2ccccc2)=O)=C\c(cccc2)c2O)=O)o1)=O |
| InChI | InChI=1S/C27H20N4O6/c32-24-9-5-4-8-20(24)16-23(29-26(33)19-6-2-1-3-7-19)27(34)30-28-17-22-14-15-25(37-22)18-10-12-21(13-11-18)31(35)36/h1-17,32H,(H,29,33)(H,30,34) |
| InChIK | SFWBHLYJZNERSI-UHFFFAOYSA-N |
| TotalMolweight | 496.478 |
| Molweight | 496.478 |
| MonoisotopicMass | 496.138286 |
| CLogP | 4.4899 |
| CLogS | -7.09 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 380.14 |
| Relative PSA | 0.31078 |
| PolarSurfaceArea | 149.75 |
| Druglikeness | 2.9882 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54054 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(2-hydroxyphenyl)-3-[(2Z)-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(2-hydroxyphenyl)-3-[(2Z)-2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide