| MolName | (Z)-1-[4-[3-(4-bromophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C24H19N6Br |
| Smiles | Brc1ccc(C(C2)N(c3ccc(/C=N\n4cnnc4)cc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19BrN6/c25-21-10-8-20(9-11-21)24-14-23(19-4-2-1-3-5-19)29-31(24)22-12-6-18(7-13-22)15-28-30-16-26-27-17-30/h1-13,15-17,24H,14H2/t24-/m0/s1 |
| InChIK | SGASLFZECLGWMB-DEOSSOPVSA-N |
| TotalMolweight | 471.361 |
| Molweight | 471.361 |
| MonoisotopicMass | 470.085455 |
| CLogP | 5.4159 |
| CLogS | -8.077 |
| H Acceptors | 6 |
| TotalSurfaceArea | 328.68 |
| Relative PSA | 0.16849 |
| PolarSurfaceArea | 58.67 |
| Druglikeness | 2.509 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 3 |
| StereoCon | racemate |
Click to Load Molecule:
1 - (Z)-1-[4-[3-(4-bromophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[4-[3-(4-bromophenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(1,2,4-triazol-4-yl)methanimine