| MolName | 3-carbazol-9-yl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]propanamide |
| MolecularFormula | C29H25N3O2 |
| Smiles | O=C(CCn1c(cccc2)c2c2c1cccc2)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H25N3O2/c33-29(18-19-32-27-12-6-4-10-25(27)26-11-5-7-13-28(26)32)31-30-20-22-14-16-24(17-15-22)34-21-23-8-2-1-3-9-23/h1-17,20H,18-19,21H2,(H,31,33) |
| InChIK | SGIWBQNTTRRFHP-UHFFFAOYSA-N |
| TotalMolweight | 447.536 |
| Molweight | 447.536 |
| MonoisotopicMass | 447.194677 |
| CLogP | 5.9878 |
| CLogS | -6.488 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 356.43 |
| Relative PSA | 0.14836 |
| PolarSurfaceArea | 55.62 |
| Druglikeness | 5.7372 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 4 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-carbazol-9-yl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]propanamide | 2 - 3-carbazol-9-yl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]propanamide