| MolName | (Z)-1-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]methylideneamino]methanimine |
| MolecularFormula | C29H25N3O2Cl2F2S |
| Smiles | FC(F)Sc(cc1)ccc1-c1ccc(/C=N\N=C/C(CC/C2=C\c(ccc(Cl)c3)c3Cl)=C2N2CCOCC2)o1 |
| InChI | InChI=1S/C29H25Cl2F2N3O2S/c30-23-6-3-20(26(31)16-23)15-21-1-2-22(28(21)36-11-13-37-14-12-36)17-34-35-18-24-7-10-27(38-24)19-4-8-25(9-5-19)39-29(32)33/h3-10,15-18,29H,1-2,11-14H2 |
| InChIK | SGKAWNJVJIEDDE-UHFFFAOYSA-N |
| TotalMolweight | 588.505 |
| Molweight | 588.505 |
| MonoisotopicMass | 587.101257 |
| CLogP | 9.4109 |
| CLogS | -9.099 |
| H Acceptors | 5 |
| TotalSurfaceArea | 429.01 |
| Relative PSA | 0.1589 |
| PolarSurfaceArea | 75.63 |
| Druglikeness | 1.6442 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.58974 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 9 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]methylideneamino]methanimine | 2 - (Z)-1-[(3E)-3-[(2,4-dichlorophenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-[5-[4-(difluoromethylsulfanyl)phenyl]furan-2-yl]methylideneamino]methanimine