| MolName | (E)-3-(4-nitrophenyl)-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)prop-2-en-1-imine |
| MolecularFormula | C21H14N4O3 |
| Smiles | [O-][N+](c1ccc(/C=C/C=N/c(cc2)cc3c2oc(-c2ccncc2)n3)cc1)=O |
| InChI | InChI=1S/C21H14N4O3/c26-25(27)18-6-3-15(4-7-18)2-1-11-23-17-5-8-20-19(14-17)24-21(28-20)16-9-12-22-13-10-16/h1-14H |
| InChIK | SHCBMDRLQCEMRS-UHFFFAOYSA-N |
| TotalMolweight | 370.367 |
| Molweight | 370.367 |
| MonoisotopicMass | 370.106591 |
| CLogP | 2.784 |
| CLogS | -6.105 |
| H Acceptors | 7 |
| TotalSurfaceArea | 289.52 |
| Relative PSA | 0.26934 |
| PolarSurfaceArea | 97.1 |
| Druglikeness | -5.1055 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-(4-nitrophenyl)-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)prop-2-en-1-imine | 2 - (E)-3-(4-nitrophenyl)-N-(2-pyridin-4-yl-1,3-benzoxazol-5-yl)prop-2-en-1-imine