| MolName | (Z)-1-anthracen-9-yl-N-morpholin-4-ylmethanimine |
| MolecularFormula | C19H18N2O |
| Smiles | C(COCC1)N1/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C19H18N2O/c1-3-7-17-15(5-1)13-16-6-2-4-8-18(16)19(17)14-20-21-9-11-22-12-10-21/h1-8,13-14H,9-12H2 |
| InChIK | SHLBSYBOFHHNJU-UHFFFAOYSA-N |
| TotalMolweight | 290.365 |
| Molweight | 290.365 |
| MonoisotopicMass | 290.141913 |
| CLogP | 3.8803 |
| CLogS | -5.043 |
| H Acceptors | 3 |
| TotalSurfaceArea | 229.06 |
| Relative PSA | 0.1094 |
| PolarSurfaceArea | 24.83 |
| Druglikeness | 2.8656 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 6 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-anthracen-9-yl-N-morpholin-4-ylmethanimine | 2 - (Z)-1-anthracen-9-yl-N-morpholin-4-ylmethanimine