| MolName | 2-[5-[(Z)-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C24H22N2O5 |
| Smiles | OC(c(cccc1)c1-c1ccc(/C=N\NC(COc2cc(CCCC3)c3cc2)=O)o1)=O |
| InChI | InChI=1S/C24H22N2O5/c27-23(15-30-18-10-9-16-5-1-2-6-17(16)13-18)26-25-14-19-11-12-22(31-19)20-7-3-4-8-21(20)24(28)29/h3-4,7-14H,1-2,5-6,15H2,(H,26,27)(H,28,29) |
| InChIK | SHNBVAYOCZOZCV-UHFFFAOYSA-N |
| TotalMolweight | 418.448 |
| Molweight | 418.448 |
| MonoisotopicMass | 418.152873 |
| CLogP | 4.3573 |
| CLogS | -6.066 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 325.84 |
| Relative PSA | 0.26473 |
| PolarSurfaceArea | 101.13 |
| Druglikeness | 0.9554 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[5-[(Z)-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 2-[5-[(Z)-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid