| MolName | (Z,Z)-2-chloro-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-phenylprop-2-en-1-imine |
| MolecularFormula | C18H14N2Cl2 |
| Smiles | Cl/C(/C=N\N=C/C(/Cl)=C/c1ccccc1)=C\c1ccccc1 |
| InChI | InChI=1S/C18H14Cl2N2/c19-17(11-15-7-3-1-4-8-15)13-21-22-14-18(20)12-16-9-5-2-6-10-16/h1-14H |
| InChIK | SHRQTSDSSHHVMU-UHFFFAOYSA-N |
| TotalMolweight | 329.229 |
| Molweight | 329.229 |
| MonoisotopicMass | 328.053402 |
| CLogP | 5.7454 |
| CLogS | -6.098 |
| H Acceptors | 2 |
| TotalSurfaceArea | 262.8 |
| Relative PSA | 0.087595 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 1.8999 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 13 |
| StereoCon |
Click to Load Molecule:
1 - (Z,Z)-2-chloro-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-phenylprop-2-en-1-imine | 2 - (Z,Z)-2-chloro-N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-phenylprop-2-en-1-imine