| MolName | [4-bromo-2-[(Z)-[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| MolecularFormula | C22H14N4O8Br2 |
| Smiles | [O-][N+](c(cc1)ccc1C(Oc(cc1)c(/C=N\NC(COc(ccc([N+]([O-])=O)c2)c2Br)=O)cc1Br)=O)=O |
| InChI | InChI=1S/C22H14Br2N4O8/c23-15-3-7-19(36-22(30)13-1-4-16(5-2-13)27(31)32)14(9-15)11-25-26-21(29)12-35-20-8-6-17(28(33)34)10-18(20)24/h1-11H,12H2,(H,26,29) |
| InChIK | SIBFDYBLZIYIOG-UHFFFAOYSA-N |
| TotalMolweight | 622.181 |
| Molweight | 622.181 |
| MonoisotopicMass | 619.917838 |
| CLogP | 3.8142 |
| CLogS | -7.559 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 382.86 |
| Relative PSA | 0.33926 |
| PolarSurfaceArea | 168.63 |
| Druglikeness | -2.8759 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate | 2 - [4-bromo-2-[(Z)-[[2-(2-bromo-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate