| MolName | 2-N,5-N-bis[(Z)-thiophen-2-ylmethylideneamino]furan-2,5-dicarboxamide |
| MolecularFormula | C16H12N4O3S2 |
| Smiles | O=C(c1ccc(C(N/N=C\c2cccs2)=O)o1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C16H12N4O3S2/c21-15(19-17-9-11-3-1-7-24-11)13-5-6-14(23-13)16(22)20-18-10-12-4-2-8-25-12/h1-10H,(H,19,21)(H,20,22) |
| InChIK | SIXSZWRIHKKKNQ-UHFFFAOYSA-N |
| TotalMolweight | 372.428 |
| Molweight | 372.428 |
| MonoisotopicMass | 372.035081 |
| CLogP | 3.7195 |
| CLogS | -5.552 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 282.29 |
| Relative PSA | 0.44936 |
| PolarSurfaceArea | 152.54 |
| Druglikeness | 6.8171 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - 2-N,5-N-bis[(Z)-thiophen-2-ylmethylideneamino]furan-2,5-dicarboxamide | 2 - 2-N,5-N-bis[(Z)-thiophen-2-ylmethylideneamino]furan-2,5-dicarboxamide