| MolName | 2-[[4-[(Z)-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]methyl]benzonitrile |
| MolecularFormula | C24H19N3O3 |
| Smiles | N#Cc1c(COc2ccc(/C=N\N(C([C@H]3[C@@H]4[C@@H]5C=C[C@H]3C5)=O)C4=O)cc2)cccc1 |
| InChI | InChI=1S/C24H19N3O3/c25-12-18-3-1-2-4-19(18)14-30-20-9-5-15(6-10-20)13-26-27-23(28)21-16-7-8-17(11-16)22(21)24(27)29/h1-10,13,16-17,21-22H,11,14H2/t16-,17-,21+,22+/m1/s1 |
| InChIK | SKBDWWBFYVTNIZ-YAKVFXAGSA-N |
| TotalMolweight | 397.433 |
| Molweight | 397.433 |
| MonoisotopicMass | 397.142642 |
| CLogP | 2.9222 |
| CLogS | -5.382 |
| H Acceptors | 6 |
| TotalSurfaceArea | 298.81 |
| Relative PSA | 0.21653 |
| PolarSurfaceArea | 82.76 |
| Druglikeness | 0.18279 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-[[4-[(Z)-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]methyl]benzonitrile | 2 - 2-[[4-[(Z)-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]phenoxy]methyl]benzonitrile